C18H15Cl2N3 — CID 1219169
1-(2,4-dichlorophenyl)-N-(3,5-dimethyl-1-phenylpyrazol-4-yl)methanimine (PubChem CID 1219169) has the molecular formula C18H15Cl2N3 and a molecular weight of 344.25 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)-N-(3,5-dimethyl-1-phenylpyrazol-4-yl)methanimine.
| Compound Name | 1-(2,4-dichlorophenyl)-N-(3,5-dimethyl-1-phenylpyrazol-4-yl)methanimine |
|---|---|
| PubChem CID | 1219169 |
| Molecular Formula | C18H15Cl2N3 |
| Molecular Weight | 344.25 g/mol |
| Exact Mass | 343.06 |
| IUPAC Name | 1-(2,4-dichlorophenyl)-N-(3,5-dimethyl-1-phenylpyrazol-4-yl)methanimine |
| SMILES | Cc1nn(-c2ccccc2)c(C)c1/N=C/c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C18H15Cl2N3/c1-12-18(21-11-14-8-9-15(19)10-17(14)20)13(2)23(22-12)16-6-4-3-5-7-16/h3-11H,1-2H3/b21-11+ |
| InChIKey | UYLLAMRRYVCVFG-SRZZPIQSSA-N |
| XLogP | 5.55 |
| TPSA | 30.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.25 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|