C18H23N3O3S — CID 122009852
5-phenyl-4-[2-(1,3-thiazol-2-yl)propylcarbamoylamino]pentanoic acid (PubChem CID 122009852) has the molecular formula C18H23N3O3S and a molecular weight of 361.47 g/mol. Its IUPAC name is 5-phenyl-4-[2-(1,3-thiazol-2-yl)propylcarbamoylamino]pentanoic acid.
| Compound Name | 5-phenyl-4-[2-(1,3-thiazol-2-yl)propylcarbamoylamino]pentanoic acid |
|---|---|
| PubChem CID | 122009852 |
| Molecular Formula | C18H23N3O3S |
| Molecular Weight | 361.47 g/mol |
| Exact Mass | 361.15 |
| IUPAC Name | 5-phenyl-4-[2-(1,3-thiazol-2-yl)propylcarbamoylamino]pentanoic acid |
| SMILES | CC(CNC(=O)NC(CCC(=O)O)Cc1ccccc1)c1nccs1 |
| InChI | InChI=1S/C18H23N3O3S/c1-13(17-19-9-10-25-17)12-20-18(24)21-15(7-8-16(22)23)11-14-5-3-2-4-6-14/h2-6,9-10,13,15H,7-8,11-12H2,1H3,(H,22,23)(H2,20,21,24) |
| InChIKey | SEQLMOIEKURFAM-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.47 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |