C21H30N2O4 — CID 122027955
4-[[2-(hydroxymethyl)spiro[3.3]heptan-2-yl]methylcarbamoylamino]-5-phenylpentanoic acid (PubChem CID 122027955) has the molecular formula C21H30N2O4 and a molecular weight of 374.48 g/mol. Its IUPAC name is 4-[[2-(hydroxymethyl)spiro[3.3]heptan-2-yl]methylcarbamoylamino]-5-phenylpentanoic acid.
| Compound Name | 4-[[2-(hydroxymethyl)spiro[3.3]heptan-2-yl]methylcarbamoylamino]-5-phenylpentanoic acid |
|---|---|
| PubChem CID | 122027955 |
| Molecular Formula | C21H30N2O4 |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.22 |
| IUPAC Name | 4-[[2-(hydroxymethyl)spiro[3.3]heptan-2-yl]methylcarbamoylamino]-5-phenylpentanoic acid |
| SMILES | O=C(O)CCC(Cc1ccccc1)NC(=O)NCC1(CO)CC2(CCC2)C1 |
| InChI | InChI=1S/C21H30N2O4/c24-15-21(12-20(13-21)9-4-10-20)14-22-19(27)23-17(7-8-18(25)26)11-16-5-2-1-3-6-16/h1-3,5-6,17,24H,4,7-15H2,(H,25,26)(H2,22,23,27) |
| InChIKey | CFIDEMXQHGBZKC-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |