C18H25N5O3 — CID 122028164
4-[[ethyl-[(1-methyltriazol-4-yl)methyl]carbamoyl]amino]-5-phenylpentanoic acid (PubChem CID 122028164) has the molecular formula C18H25N5O3 and a molecular weight of 359.43 g/mol. Its IUPAC name is 4-[[ethyl-[(1-methyltriazol-4-yl)methyl]carbamoyl]amino]-5-phenylpentanoic acid.
| Compound Name | 4-[[ethyl-[(1-methyltriazol-4-yl)methyl]carbamoyl]amino]-5-phenylpentanoic acid |
|---|---|
| PubChem CID | 122028164 |
| Molecular Formula | C18H25N5O3 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.20 |
| IUPAC Name | 4-[[ethyl-[(1-methyltriazol-4-yl)methyl]carbamoyl]amino]-5-phenylpentanoic acid |
| SMILES | CCN(Cc1cn(C)nn1)C(=O)NC(CCC(=O)O)Cc1ccccc1 |
| InChI | InChI=1S/C18H25N5O3/c1-3-23(13-16-12-22(2)21-20-16)18(26)19-15(9-10-17(24)25)11-14-7-5-4-6-8-14/h4-8,12,15H,3,9-11,13H2,1-2H3,(H,19,26)(H,24,25) |
| InChIKey | GAGCZZRKTSITOI-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 100.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |