C15H17N3O2 — CID 122032052
4-[(4,5,6,7-tetrahydro-1H-indazol-7-ylamino)methyl]benzoic acid (PubChem CID 122032052) has the molecular formula C15H17N3O2 and a molecular weight of 271.32 g/mol. Its IUPAC name is 4-[(4,5,6,7-tetrahydro-1H-indazol-7-ylamino)methyl]benzoic acid.
| Compound Name | 4-[(4,5,6,7-tetrahydro-1H-indazol-7-ylamino)methyl]benzoic acid |
|---|---|
| PubChem CID | 122032052 |
| Molecular Formula | C15H17N3O2 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.13 |
| IUPAC Name | 4-[(4,5,6,7-tetrahydro-1H-indazol-7-ylamino)methyl]benzoic acid |
| SMILES | O=C(O)c1ccc(CNC2CCCc3cn[nH]c32)cc1 |
| InChI | InChI=1S/C15H17N3O2/c19-15(20)11-6-4-10(5-7-11)8-16-13-3-1-2-12-9-17-18-14(12)13/h4-7,9,13,16H,1-3,8H2,(H,17,18)(H,19,20) |
| InChIKey | ASFYDOSWILYGGV-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |