C14H14Cl2FN3 — CID 166229001
N-[(2,3-dichloro-4-fluorophenyl)methyl]-4,5,6,7-tetrahydro-1H-indazol-7-amine (PubChem CID 166229001) has the molecular formula C14H14Cl2FN3 and a molecular weight of 314.19 g/mol. Its IUPAC name is N-[(2,3-dichloro-4-fluorophenyl)methyl]-4,5,6,7-tetrahydro-1H-indazol-7-amine.
| Compound Name | N-[(2,3-dichloro-4-fluorophenyl)methyl]-4,5,6,7-tetrahydro-1H-indazol-7-amine |
|---|---|
| PubChem CID | 166229001 |
| Molecular Formula | C14H14Cl2FN3 |
| Molecular Weight | 314.19 g/mol |
| Exact Mass | 313.05 |
| IUPAC Name | N-[(2,3-dichloro-4-fluorophenyl)methyl]-4,5,6,7-tetrahydro-1H-indazol-7-amine |
| SMILES | Fc1ccc(CNC2CCCc3cn[nH]c32)c(Cl)c1Cl |
| InChI | InChI=1S/C14H14Cl2FN3/c15-12-8(4-5-10(17)13(12)16)6-18-11-3-1-2-9-7-19-20-14(9)11/h4-5,7,11,18H,1-3,6H2,(H,19,20) |
| InChIKey | KZUQHDCGGDZWGV-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.19 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|