C21H26N2O2 — CID 122033082
4-[[[2-[benzyl(methyl)amino]-2-cyclopropylethyl]amino]methyl]benzoic acid (PubChem CID 122033082) has the molecular formula C21H26N2O2 and a molecular weight of 338.45 g/mol. Its IUPAC name is 4-[[[2-[benzyl(methyl)amino]-2-cyclopropylethyl]amino]methyl]benzoic acid.
| Compound Name | 4-[[[2-[benzyl(methyl)amino]-2-cyclopropylethyl]amino]methyl]benzoic acid |
|---|---|
| PubChem CID | 122033082 |
| Molecular Formula | C21H26N2O2 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.20 |
| IUPAC Name | 4-[[[2-[benzyl(methyl)amino]-2-cyclopropylethyl]amino]methyl]benzoic acid |
| SMILES | CN(Cc1ccccc1)C(CNCc1ccc(C(=O)O)cc1)C1CC1 |
| InChI | InChI=1S/C21H26N2O2/c1-23(15-17-5-3-2-4-6-17)20(18-11-12-18)14-22-13-16-7-9-19(10-8-16)21(24)25/h2-10,18,20,22H,11-15H2,1H3,(H,24,25) |
| InChIKey | COYJQYQOMZMUCO-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |