About 4-[[(2-cyclopropyl-1,3-oxazol-5-yl)methylamino]methyl]benzoic acid
4-[[(2-cyclopropyl-1,3-oxazol-5-yl)methylamino]methyl]benzoic acid (PubChem CID 122035175) has the molecular formula C15H16N2O3
and a molecular weight of 272.30 g/mol. Its IUPAC name is 4-[[(2-cyclopropyl-1,3-oxazol-5-yl)methylamino]methyl]benzoic acid.
Molecular Properties
| Compound Name | 4-[[(2-cyclopropyl-1,3-oxazol-5-yl)methylamino]methyl]benzoic acid |
| PubChem CID | 122035175 |
| Molecular Formula | C15H16N2O3 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | 4-[[(2-cyclopropyl-1,3-oxazol-5-yl)methylamino]methyl]benzoic acid |
| SMILES | O=C(O)c1ccc(CNCc2cnc(C3CC3)o2)cc1 |
| InChI | InChI=1S/C15H16N2O3/c18-15(19)12-3-1-10(2-4-12)7-16-8-13-9-17-14(20-13)11-5-6-11/h1-4,9,11,16H,5-8H2,(H,18,19) |
| InChIKey | ZRIBJIYHOHQVQN-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 75.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[[(2-cyclopropyl-1,3-oxazol-5-yl)methylamino]methyl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[(2-cyclopropyl-1,3-oxazol-5-yl)methylamino]methyl]benzoic acid?
The IUPAC name of 4-[[(2-cyclopropyl-1,3-oxazol-5-yl)methylamino]methyl]benzoic acid (CID 122035175) is 4-[[(2-cyclopropyl-1,3-oxazol-5-yl)methylamino]methyl]benzoic acid.
What is the SMILES notation for 4-[[(2-cyclopropyl-1,3-oxazol-5-yl)methylamino]methyl]benzoic acid?
The canonical SMILES for 4-[[(2-cyclopropyl-1,3-oxazol-5-yl)methylamino]methyl]benzoic acid is O=C(O)c1ccc(CNCc2cnc(C3CC3)o2)cc1.
What is the InChIKey of 4-[[(2-cyclopropyl-1,3-oxazol-5-yl)methylamino]methyl]benzoic acid?
The InChIKey is ZRIBJIYHOHQVQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16N2O3/c18-15(19)12-3-1-10(2-4-12)7-16-8-13-9-17-14(20-13)11-5-6-11/h1-4,9,11,16H,5-8H2,(H,18,19).
What are the key properties of 4-[[(2-cyclopropyl-1,3-oxazol-5-yl)methylamino]methyl]benzoic acid?
4-[[(2-cyclopropyl-1,3-oxazol-5-yl)methylamino]methyl]benzoic acid has a molecular weight of 272.30 g/mol, XLogP of 2.54, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[(2-cyclopropyl-1,3-oxazol-5-yl)methylamino]methyl]benzoic acid is sourced from PubChem (CID 122035175), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).