C14H14N2O3 — CID 122035283
4-[[(5-cyclopropyl-1,2-oxazol-4-yl)amino]methyl]benzoic acid (PubChem CID 122035283) has the molecular formula C14H14N2O3 and a molecular weight of 258.28 g/mol. Its IUPAC name is 4-[[(5-cyclopropyl-1,2-oxazol-4-yl)amino]methyl]benzoic acid.
| Compound Name | 4-[[(5-cyclopropyl-1,2-oxazol-4-yl)amino]methyl]benzoic acid |
|---|---|
| PubChem CID | 122035283 |
| Molecular Formula | C14H14N2O3 |
| Molecular Weight | 258.28 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | 4-[[(5-cyclopropyl-1,2-oxazol-4-yl)amino]methyl]benzoic acid |
| SMILES | O=C(O)c1ccc(CNc2cnoc2C2CC2)cc1 |
| InChI | InChI=1S/C14H14N2O3/c17-14(18)11-3-1-9(2-4-11)7-15-12-8-16-19-13(12)10-5-6-10/h1-4,8,10,15H,5-7H2,(H,17,18) |
| InChIKey | QZCCWMUIBKXKDE-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 75.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.28 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |