4-(2,3-dihydro-1H-inden-1-ylamino)-5-phenylpentanoic acid

C20H23NO2 — CID 122045757

IUPAC4-(2,3-dihydro-1H-inden-1-ylamino)-5-phenylpentanoic acid
SMILESO=C(O)CCC(Cc1ccccc1)NC1CCc2ccccc21
InChIInChI=1S/C20H23NO2/c22-20(23)13-11-17(14-15-6-2-1-3-7-15)21-19-12-10-16-8-4-5-9-18(16)19/h1-9,17,19,21H,10-14H2,(H,22,23)
InChIKeyNIWVQRXJFZKMEA-UHFFFAOYSA-N
MW309.41 g/mol
LogP3.74
Rot. Bonds7

About 4-(2,3-dihydro-1H-inden-1-ylamino)-5-phenylpentanoic acid

4-(2,3-dihydro-1H-inden-1-ylamino)-5-phenylpentanoic acid (PubChem CID 122045757) has the molecular formula C20H23NO2 and a molecular weight of 309.41 g/mol. Its IUPAC name is 4-(2,3-dihydro-1H-inden-1-ylamino)-5-phenylpentanoic acid.

Molecular Properties

Compound Name4-(2,3-dihydro-1H-inden-1-ylamino)-5-phenylpentanoic acid
PubChem CID122045757
Molecular FormulaC20H23NO2
Molecular Weight309.41 g/mol
Exact Mass309.17
IUPAC Name4-(2,3-dihydro-1H-inden-1-ylamino)-5-phenylpentanoic acid
SMILESO=C(O)CCC(Cc1ccccc1)NC1CCc2ccccc21
InChIInChI=1S/C20H23NO2/c22-20(23)13-11-17(14-15-6-2-1-3-7-15)21-19-12-10-16-8-4-5-9-18(16)19/h1-9,17,19,21H,10-14H2,(H,22,23)
InChIKeyNIWVQRXJFZKMEA-UHFFFAOYSA-N
XLogP3.74
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds7
Heavy Atoms23
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500309.41
LogP ≤ 53.74
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 4-(2,3-dihydro-1H-inden-1-ylamino)-5-phenylpentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(2,3-dihydro-1H-inden-1-ylamino)-5-phenylpentanoic acid?
The IUPAC name of 4-(2,3-dihydro-1H-inden-1-ylamino)-5-phenylpentanoic acid (CID 122045757) is 4-(2,3-dihydro-1H-inden-1-ylamino)-5-phenylpentanoic acid.
What is the SMILES notation for 4-(2,3-dihydro-1H-inden-1-ylamino)-5-phenylpentanoic acid?
The canonical SMILES for 4-(2,3-dihydro-1H-inden-1-ylamino)-5-phenylpentanoic acid is O=C(O)CCC(Cc1ccccc1)NC1CCc2ccccc21.
What is the InChIKey of 4-(2,3-dihydro-1H-inden-1-ylamino)-5-phenylpentanoic acid?
The InChIKey is NIWVQRXJFZKMEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H23NO2/c22-20(23)13-11-17(14-15-6-2-1-3-7-15)21-19-12-10-16-8-4-5-9-18(16)19/h1-9,17,19,21H,10-14H2,(H,22,23).
What are the key properties of 4-(2,3-dihydro-1H-inden-1-ylamino)-5-phenylpentanoic acid?
4-(2,3-dihydro-1H-inden-1-ylamino)-5-phenylpentanoic acid has a molecular weight of 309.41 g/mol, XLogP of 3.74, 7 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,3-dihydro-1H-inden-1-ylamino)-5-phenylpentanoic acid is sourced from PubChem (CID 122045757), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).