C19H18N4O4 — CID 122054283
5-[3-(1-benzofuran-2-carbonylamino)piperidin-1-yl]pyrazine-2-carboxylic acid (PubChem CID 122054283) has the molecular formula C19H18N4O4 and a molecular weight of 366.38 g/mol. Its IUPAC name is 5-[3-(1-benzofuran-2-carbonylamino)piperidin-1-yl]pyrazine-2-carboxylic acid.
| Compound Name | 5-[3-(1-benzofuran-2-carbonylamino)piperidin-1-yl]pyrazine-2-carboxylic acid |
|---|---|
| PubChem CID | 122054283 |
| Molecular Formula | C19H18N4O4 |
| Molecular Weight | 366.38 g/mol |
| Exact Mass | 366.13 |
| IUPAC Name | 5-[3-(1-benzofuran-2-carbonylamino)piperidin-1-yl]pyrazine-2-carboxylic acid |
| SMILES | O=C(O)c1cnc(N2CCCC(NC(=O)c3cc4ccccc4o3)C2)cn1 |
| InChI | InChI=1S/C19H18N4O4/c24-18(16-8-12-4-1-2-6-15(12)27-16)22-13-5-3-7-23(11-13)17-10-20-14(9-21-17)19(25)26/h1-2,4,6,8-10,13H,3,5,7,11H2,(H,22,24)(H,25,26) |
| InChIKey | VRDAOLPDEJJPHD-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 108.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.38 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |