C15H13F2N3O4 — CID 122060998
3-[[3-cyano-6-(difluoromethoxy)quinolin-4-yl]amino]-2-hydroxy-2-methylpropanoic acid (PubChem CID 122060998) has the molecular formula C15H13F2N3O4 and a molecular weight of 337.28 g/mol. Its IUPAC name is 3-[[3-cyano-6-(difluoromethoxy)quinolin-4-yl]amino]-2-hydroxy-2-methylpropanoic acid.
| Compound Name | 3-[[3-cyano-6-(difluoromethoxy)quinolin-4-yl]amino]-2-hydroxy-2-methylpropanoic acid |
|---|---|
| PubChem CID | 122060998 |
| Molecular Formula | C15H13F2N3O4 |
| Molecular Weight | 337.28 g/mol |
| Exact Mass | 337.09 |
| IUPAC Name | 3-[[3-cyano-6-(difluoromethoxy)quinolin-4-yl]amino]-2-hydroxy-2-methylpropanoic acid |
| SMILES | CC(O)(CNc1c(C#N)cnc2ccc(OC(F)F)cc12)C(=O)O |
| InChI | InChI=1S/C15H13F2N3O4/c1-15(23,13(21)22)7-20-12-8(5-18)6-19-11-3-2-9(4-10(11)12)24-14(16)17/h2-4,6,14,23H,7H2,1H3,(H,19,20)(H,21,22) |
| InChIKey | PSGAIZCYDLQFPM-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 115.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.28 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |