C18H18F2N4O3 — CID 133273498
methyl 4-[[3-cyano-6-(difluoromethoxy)quinolin-4-yl]amino]piperidine-1-carboxylate (PubChem CID 133273498) has the molecular formula C18H18F2N4O3 and a molecular weight of 376.36 g/mol. Its IUPAC name is methyl 4-[[3-cyano-6-(difluoromethoxy)quinolin-4-yl]amino]piperidine-1-carboxylate.
| Compound Name | methyl 4-[[3-cyano-6-(difluoromethoxy)quinolin-4-yl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 133273498 |
| Molecular Formula | C18H18F2N4O3 |
| Molecular Weight | 376.36 g/mol |
| Exact Mass | 376.13 |
| IUPAC Name | methyl 4-[[3-cyano-6-(difluoromethoxy)quinolin-4-yl]amino]piperidine-1-carboxylate |
| SMILES | COC(=O)N1CCC(Nc2c(C#N)cnc3ccc(OC(F)F)cc23)CC1 |
| InChI | InChI=1S/C18H18F2N4O3/c1-26-18(25)24-6-4-12(5-7-24)23-16-11(9-21)10-22-15-3-2-13(8-14(15)16)27-17(19)20/h2-3,8,10,12,17H,4-7H2,1H3,(H,22,23) |
| InChIKey | XUTRLCKXFRUXCA-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 87.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.36 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |