C20H19F2N5O — CID 133386076
4-[(1-cyclopentylpyrazol-3-yl)methylamino]-6-(difluoromethoxy)quinoline-3-carbonitrile (PubChem CID 133386076) has the molecular formula C20H19F2N5O and a molecular weight of 383.40 g/mol. Its IUPAC name is 4-[(1-cyclopentylpyrazol-3-yl)methylamino]-6-(difluoromethoxy)quinoline-3-carbonitrile.
| Compound Name | 4-[(1-cyclopentylpyrazol-3-yl)methylamino]-6-(difluoromethoxy)quinoline-3-carbonitrile |
|---|---|
| PubChem CID | 133386076 |
| Molecular Formula | C20H19F2N5O |
| Molecular Weight | 383.40 g/mol |
| Exact Mass | 383.16 |
| IUPAC Name | 4-[(1-cyclopentylpyrazol-3-yl)methylamino]-6-(difluoromethoxy)quinoline-3-carbonitrile |
| SMILES | N#Cc1cnc2ccc(OC(F)F)cc2c1NCc1ccn(C2CCCC2)n1 |
| InChI | InChI=1S/C20H19F2N5O/c21-20(22)28-16-5-6-18-17(9-16)19(13(10-23)11-24-18)25-12-14-7-8-27(26-14)15-3-1-2-4-15/h5-9,11,15,20H,1-4,12H2,(H,24,25) |
| InChIKey | YGSRGMNWNLBWLE-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 75.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.40 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |