C18H20F2N4O3S — CID 133434055
6-(difluoromethoxy)-4-[3-(1,1-dioxo-1,4-thiazinan-4-yl)propylamino]quinoline-3-carbonitrile (PubChem CID 133434055) has the molecular formula C18H20F2N4O3S and a molecular weight of 410.45 g/mol. Its IUPAC name is 6-(difluoromethoxy)-4-[3-(1,1-dioxo-1,4-thiazinan-4-yl)propylamino]quinoline-3-carbonitrile.
| Compound Name | 6-(difluoromethoxy)-4-[3-(1,1-dioxo-1,4-thiazinan-4-yl)propylamino]quinoline-3-carbonitrile |
|---|---|
| PubChem CID | 133434055 |
| Molecular Formula | C18H20F2N4O3S |
| Molecular Weight | 410.45 g/mol |
| Exact Mass | 410.12 |
| IUPAC Name | 6-(difluoromethoxy)-4-[3-(1,1-dioxo-1,4-thiazinan-4-yl)propylamino]quinoline-3-carbonitrile |
| SMILES | N#Cc1cnc2ccc(OC(F)F)cc2c1NCCCN1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C18H20F2N4O3S/c19-18(20)27-14-2-3-16-15(10-14)17(13(11-21)12-23-16)22-4-1-5-24-6-8-28(25,26)9-7-24/h2-3,10,12,18H,1,4-9H2,(H,22,23) |
| InChIKey | NBWCFQFUDODXGO-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 95.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.45 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|