C15H14F3N3O5 — CID 122064068
(3S,4S)-1-(6-nitro-2-oxo-3,4-dihydro-1H-quinolin-7-yl)-4-(trifluoromethyl)pyrrolidine-3-carboxylic acid (PubChem CID 122064068) has the molecular formula C15H14F3N3O5 and a molecular weight of 373.29 g/mol. Its IUPAC name is (3S,4S)-1-(6-nitro-2-oxo-3,4-dihydro-1H-quinolin-7-yl)-4-(trifluoromethyl)pyrrolidine-3-carboxylic acid.
| Compound Name | (3S,4S)-1-(6-nitro-2-oxo-3,4-dihydro-1H-quinolin-7-yl)-4-(trifluoromethyl)pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 122064068 |
| Molecular Formula | C15H14F3N3O5 |
| Molecular Weight | 373.29 g/mol |
| Exact Mass | 373.09 |
| IUPAC Name | (3S,4S)-1-(6-nitro-2-oxo-3,4-dihydro-1H-quinolin-7-yl)-4-(trifluoromethyl)pyrrolidine-3-carboxylic acid |
| SMILES | O=C1CCc2cc([N+](=O)[O-])c(N3C[C@@H](C(F)(F)F)[C@H](C(=O)O)C3)cc2N1 |
| InChI | InChI=1S/C15H14F3N3O5/c16-15(17,18)9-6-20(5-8(9)14(23)24)11-4-10-7(1-2-13(22)19-10)3-12(11)21(25)26/h3-4,8-9H,1-2,5-6H2,(H,19,22)(H,23,24)/t8-,9-/m1/s1 |
| InChIKey | GVWJHPMSSDSHRS-RKDXNWHRSA-N |
| XLogP | 2.18 |
| TPSA | 112.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.29 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|