C13H16ClN5O4S — CID 122069985
2-[[4-chloro-3-(2H-tetrazol-5-yl)phenyl]sulfonylamino]hexanoic acid (PubChem CID 122069985) has the molecular formula C13H16ClN5O4S and a molecular weight of 373.82 g/mol. Its IUPAC name is 2-[[4-chloro-3-(2H-tetrazol-5-yl)phenyl]sulfonylamino]hexanoic acid.
| Compound Name | 2-[[4-chloro-3-(2H-tetrazol-5-yl)phenyl]sulfonylamino]hexanoic acid |
|---|---|
| PubChem CID | 122069985 |
| Molecular Formula | C13H16ClN5O4S |
| Molecular Weight | 373.82 g/mol |
| Exact Mass | 373.06 |
| IUPAC Name | 2-[[4-chloro-3-(2H-tetrazol-5-yl)phenyl]sulfonylamino]hexanoic acid |
| SMILES | CCCCC(NS(=O)(=O)c1ccc(Cl)c(-c2nn[nH]n2)c1)C(=O)O |
| InChI | InChI=1S/C13H16ClN5O4S/c1-2-3-4-11(13(20)21)17-24(22,23)8-5-6-10(14)9(7-8)12-15-18-19-16-12/h5-7,11,17H,2-4H2,1H3,(H,20,21)(H,15,16,18,19) |
| InChIKey | MHGROMYQSDKDFN-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 137.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.82 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |