C15H20FN3O6S — CID 122076915
4-[(4-fluoro-3-morpholin-4-ylsulfonylphenyl)carbamoylamino]butanoic acid (PubChem CID 122076915) has the molecular formula C15H20FN3O6S and a molecular weight of 389.41 g/mol. Its IUPAC name is 4-[(4-fluoro-3-morpholin-4-ylsulfonylphenyl)carbamoylamino]butanoic acid.
| Compound Name | 4-[(4-fluoro-3-morpholin-4-ylsulfonylphenyl)carbamoylamino]butanoic acid |
|---|---|
| PubChem CID | 122076915 |
| Molecular Formula | C15H20FN3O6S |
| Molecular Weight | 389.41 g/mol |
| Exact Mass | 389.11 |
| IUPAC Name | 4-[(4-fluoro-3-morpholin-4-ylsulfonylphenyl)carbamoylamino]butanoic acid |
| SMILES | O=C(O)CCCNC(=O)Nc1ccc(F)c(S(=O)(=O)N2CCOCC2)c1 |
| InChI | InChI=1S/C15H20FN3O6S/c16-12-4-3-11(18-15(22)17-5-1-2-14(20)21)10-13(12)26(23,24)19-6-8-25-9-7-19/h3-4,10H,1-2,5-9H2,(H,20,21)(H2,17,18,22) |
| InChIKey | WPDZGCZAJUBZRX-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 125.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.41 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|