C12H14N4O3 — CID 122092334
4-(imidazo[1,2-a]pyridin-7-ylcarbamoylamino)butanoic acid (PubChem CID 122092334) has the molecular formula C12H14N4O3 and a molecular weight of 262.27 g/mol. Its IUPAC name is 4-(imidazo[1,2-a]pyridin-7-ylcarbamoylamino)butanoic acid.
| Compound Name | 4-(imidazo[1,2-a]pyridin-7-ylcarbamoylamino)butanoic acid |
|---|---|
| PubChem CID | 122092334 |
| Molecular Formula | C12H14N4O3 |
| Molecular Weight | 262.27 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | 4-(imidazo[1,2-a]pyridin-7-ylcarbamoylamino)butanoic acid |
| SMILES | O=C(O)CCCNC(=O)Nc1ccn2ccnc2c1 |
| InChI | InChI=1S/C12H14N4O3/c17-11(18)2-1-4-14-12(19)15-9-3-6-16-7-5-13-10(16)8-9/h3,5-8H,1-2,4H2,(H,17,18)(H2,14,15,19) |
| InChIKey | OLAGNHZEQISAFK-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 95.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.27 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|