About 3-[6,7-dihydro-5H-cyclopenta[b]pyridin-2-ylcarbamoyl(methyl)amino]propanoic acid
3-[6,7-dihydro-5H-cyclopenta[b]pyridin-2-ylcarbamoyl(methyl)amino]propanoic acid (PubChem CID 122094973) has the molecular formula C13H17N3O3
and a molecular weight of 263.30 g/mol. Its IUPAC name is 3-[6,7-dihydro-5H-cyclopenta[b]pyridin-2-ylcarbamoyl(methyl)amino]propanoic acid.
Molecular Properties
| Compound Name | 3-[6,7-dihydro-5H-cyclopenta[b]pyridin-2-ylcarbamoyl(methyl)amino]propanoic acid |
| PubChem CID | 122094973 |
| Molecular Formula | C13H17N3O3 |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | 3-[6,7-dihydro-5H-cyclopenta[b]pyridin-2-ylcarbamoyl(methyl)amino]propanoic acid |
| SMILES | CN(CCC(=O)O)C(=O)Nc1ccc2c(n1)CCC2 |
| InChI | InChI=1S/C13H17N3O3/c1-16(8-7-12(17)18)13(19)15-11-6-5-9-3-2-4-10(9)14-11/h5-6H,2-4,7-8H2,1H3,(H,17,18)(H,14,15,19) |
| InChIKey | JQCHTQZJKJJDGF-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[6,7-dihydro-5H-cyclopenta[b]pyridin-2-ylcarbamoyl(methyl)amino]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[6,7-dihydro-5H-cyclopenta[b]pyridin-2-ylcarbamoyl(methyl)amino]propanoic acid?
The IUPAC name of 3-[6,7-dihydro-5H-cyclopenta[b]pyridin-2-ylcarbamoyl(methyl)amino]propanoic acid (CID 122094973) is 3-[6,7-dihydro-5H-cyclopenta[b]pyridin-2-ylcarbamoyl(methyl)amino]propanoic acid.
What is the SMILES notation for 3-[6,7-dihydro-5H-cyclopenta[b]pyridin-2-ylcarbamoyl(methyl)amino]propanoic acid?
The canonical SMILES for 3-[6,7-dihydro-5H-cyclopenta[b]pyridin-2-ylcarbamoyl(methyl)amino]propanoic acid is CN(CCC(=O)O)C(=O)Nc1ccc2c(n1)CCC2.
What is the InChIKey of 3-[6,7-dihydro-5H-cyclopenta[b]pyridin-2-ylcarbamoyl(methyl)amino]propanoic acid?
The InChIKey is JQCHTQZJKJJDGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17N3O3/c1-16(8-7-12(17)18)13(19)15-11-6-5-9-3-2-4-10(9)14-11/h5-6H,2-4,7-8H2,1H3,(H,17,18)(H,14,15,19).
What are the key properties of 3-[6,7-dihydro-5H-cyclopenta[b]pyridin-2-ylcarbamoyl(methyl)amino]propanoic acid?
3-[6,7-dihydro-5H-cyclopenta[b]pyridin-2-ylcarbamoyl(methyl)amino]propanoic acid has a molecular weight of 263.30 g/mol, XLogP of 1.51, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[6,7-dihydro-5H-cyclopenta[b]pyridin-2-ylcarbamoyl(methyl)amino]propanoic acid is sourced from PubChem (CID 122094973), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).