C14H18ClN5 — CID 122097578
2-[(4-chloro-1-methylpyrazol-3-yl)methyl]-1-(3,4-dimethylphenyl)guanidine (PubChem CID 122097578) has the molecular formula C14H18ClN5 and a molecular weight of 291.79 g/mol. Its IUPAC name is 2-[(4-chloro-1-methylpyrazol-3-yl)methyl]-1-(3,4-dimethylphenyl)guanidine.
| Compound Name | 2-[(4-chloro-1-methylpyrazol-3-yl)methyl]-1-(3,4-dimethylphenyl)guanidine |
|---|---|
| PubChem CID | 122097578 |
| Molecular Formula | C14H18ClN5 |
| Molecular Weight | 291.79 g/mol |
| Exact Mass | 291.13 |
| IUPAC Name | 2-[(4-chloro-1-methylpyrazol-3-yl)methyl]-1-(3,4-dimethylphenyl)guanidine |
| SMILES | Cc1ccc(N/C(N)=N/Cc2nn(C)cc2Cl)cc1C |
| InChI | InChI=1S/C14H18ClN5/c1-9-4-5-11(6-10(9)2)18-14(16)17-7-13-12(15)8-20(3)19-13/h4-6,8H,7H2,1-3H3,(H3,16,17,18) |
| InChIKey | GCDFMGMQCMLPGQ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.79 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|