C13H22N4O — CID 122097891
N'-[(2-ethyl-1,3-oxazol-5-yl)methyl]azepane-1-carboximidamide (PubChem CID 122097891) has the molecular formula C13H22N4O and a molecular weight of 250.35 g/mol. Its IUPAC name is N'-[(2-ethyl-1,3-oxazol-5-yl)methyl]azepane-1-carboximidamide.
| Compound Name | N'-[(2-ethyl-1,3-oxazol-5-yl)methyl]azepane-1-carboximidamide |
|---|---|
| PubChem CID | 122097891 |
| Molecular Formula | C13H22N4O |
| Molecular Weight | 250.35 g/mol |
| Exact Mass | 250.18 |
| IUPAC Name | N'-[(2-ethyl-1,3-oxazol-5-yl)methyl]azepane-1-carboximidamide |
| SMILES | CCc1ncc(C/N=C(\N)N2CCCCCC2)o1 |
| InChI | InChI=1S/C13H22N4O/c1-2-12-15-9-11(18-12)10-16-13(14)17-7-5-3-4-6-8-17/h9H,2-8,10H2,1H3,(H2,14,16) |
| InChIKey | WRMJEICJTRLFAH-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 67.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.35 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|