C19H29N3O3 — CID 122098833
1-(3,4-dimethylphenyl)-2-[2-methyl-2-(1,4,7-trioxaspiro[4.4]nonan-9-yl)propyl]guanidine (PubChem CID 122098833) has the molecular formula C19H29N3O3 and a molecular weight of 347.46 g/mol. Its IUPAC name is 1-(3,4-dimethylphenyl)-2-[2-methyl-2-(1,4,7-trioxaspiro[4.4]nonan-9-yl)propyl]guanidine.
| Compound Name | 1-(3,4-dimethylphenyl)-2-[2-methyl-2-(1,4,7-trioxaspiro[4.4]nonan-9-yl)propyl]guanidine |
|---|---|
| PubChem CID | 122098833 |
| Molecular Formula | C19H29N3O3 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.22 |
| IUPAC Name | 1-(3,4-dimethylphenyl)-2-[2-methyl-2-(1,4,7-trioxaspiro[4.4]nonan-9-yl)propyl]guanidine |
| SMILES | Cc1ccc(N/C(N)=N/CC(C)(C)C2COCC23OCCO3)cc1C |
| InChI | InChI=1S/C19H29N3O3/c1-13-5-6-15(9-14(13)2)22-17(20)21-11-18(3,4)16-10-23-12-19(16)24-7-8-25-19/h5-6,9,16H,7-8,10-12H2,1-4H3,(H3,20,21,22) |
| InChIKey | QUFSOAHGACOJLV-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 78.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|