C15H20N4 — CID 122099503
2-[(1-cyanocyclobutyl)methyl]-1-(3,5-dimethylphenyl)guanidine (PubChem CID 122099503) has the molecular formula C15H20N4 and a molecular weight of 256.35 g/mol. Its IUPAC name is 2-[(1-cyanocyclobutyl)methyl]-1-(3,5-dimethylphenyl)guanidine.
| Compound Name | 2-[(1-cyanocyclobutyl)methyl]-1-(3,5-dimethylphenyl)guanidine |
|---|---|
| PubChem CID | 122099503 |
| Molecular Formula | C15H20N4 |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.17 |
| IUPAC Name | 2-[(1-cyanocyclobutyl)methyl]-1-(3,5-dimethylphenyl)guanidine |
| SMILES | Cc1cc(C)cc(N/C(N)=N/CC2(C#N)CCC2)c1 |
| InChI | InChI=1S/C15H20N4/c1-11-6-12(2)8-13(7-11)19-14(17)18-10-15(9-16)4-3-5-15/h6-8H,3-5,10H2,1-2H3,(H3,17,18,19) |
| InChIKey | NEKAXHKLENQFQB-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 74.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|