C16H18N2O5S2 — CID 122110930
5-[[3-[4-(methylsulfamoyl)phenyl]propanoylamino]methyl]thiophene-2-carboxylic acid (PubChem CID 122110930) has the molecular formula C16H18N2O5S2 and a molecular weight of 382.46 g/mol. Its IUPAC name is 5-[[3-[4-(methylsulfamoyl)phenyl]propanoylamino]methyl]thiophene-2-carboxylic acid.
| Compound Name | 5-[[3-[4-(methylsulfamoyl)phenyl]propanoylamino]methyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 122110930 |
| Molecular Formula | C16H18N2O5S2 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.07 |
| IUPAC Name | 5-[[3-[4-(methylsulfamoyl)phenyl]propanoylamino]methyl]thiophene-2-carboxylic acid |
| SMILES | CNS(=O)(=O)c1ccc(CCC(=O)NCc2ccc(C(=O)O)s2)cc1 |
| InChI | InChI=1S/C16H18N2O5S2/c1-17-25(22,23)13-6-2-11(3-7-13)4-9-15(19)18-10-12-5-8-14(24-12)16(20)21/h2-3,5-8,17H,4,9-10H2,1H3,(H,18,19)(H,20,21) |
| InChIKey | CARCYHZMANTSNE-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |