C16H23N3O4 — CID 122126228
2-[[[2-(2-carbamoylanilino)acetyl]amino]methyl]-4-methylpentanoic acid (PubChem CID 122126228) has the molecular formula C16H23N3O4 and a molecular weight of 321.38 g/mol. Its IUPAC name is 2-[[[2-(2-carbamoylanilino)acetyl]amino]methyl]-4-methylpentanoic acid.
| Compound Name | 2-[[[2-(2-carbamoylanilino)acetyl]amino]methyl]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 122126228 |
| Molecular Formula | C16H23N3O4 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | 2-[[[2-(2-carbamoylanilino)acetyl]amino]methyl]-4-methylpentanoic acid |
| SMILES | CC(C)CC(CNC(=O)CNc1ccccc1C(N)=O)C(=O)O |
| InChI | InChI=1S/C16H23N3O4/c1-10(2)7-11(16(22)23)8-19-14(20)9-18-13-6-4-3-5-12(13)15(17)21/h3-6,10-11,18H,7-9H2,1-2H3,(H2,17,21)(H,19,20)(H,22,23) |
| InChIKey | KSMPVLALCDNFPP-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |