C13H15N3O6S — CID 122126311
4-[3-(carbamoylamino)benzoyl]-1,1-dioxo-1,4-thiazinane-2-carboxylic acid (PubChem CID 122126311) has the molecular formula C13H15N3O6S and a molecular weight of 341.35 g/mol. Its IUPAC name is 4-[3-(carbamoylamino)benzoyl]-1,1-dioxo-1,4-thiazinane-2-carboxylic acid.
| Compound Name | 4-[3-(carbamoylamino)benzoyl]-1,1-dioxo-1,4-thiazinane-2-carboxylic acid |
|---|---|
| PubChem CID | 122126311 |
| Molecular Formula | C13H15N3O6S |
| Molecular Weight | 341.35 g/mol |
| Exact Mass | 341.07 |
| IUPAC Name | 4-[3-(carbamoylamino)benzoyl]-1,1-dioxo-1,4-thiazinane-2-carboxylic acid |
| SMILES | NC(=O)Nc1cccc(C(=O)N2CCS(=O)(=O)C(C(=O)O)C2)c1 |
| InChI | InChI=1S/C13H15N3O6S/c14-13(20)15-9-3-1-2-8(6-9)11(17)16-4-5-23(21,22)10(7-16)12(18)19/h1-3,6,10H,4-5,7H2,(H,18,19)(H3,14,15,20) |
| InChIKey | QEEWYXOKOAZCMY-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 146.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.35 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |