C16H23Cl2NO2 — CID 122127278
4-[1-(2,4-dichlorophenyl)butan-2-ylamino]-2,2-dimethylbutanoic acid (PubChem CID 122127278) has the molecular formula C16H23Cl2NO2 and a molecular weight of 332.27 g/mol. Its IUPAC name is 4-[1-(2,4-dichlorophenyl)butan-2-ylamino]-2,2-dimethylbutanoic acid.
| Compound Name | 4-[1-(2,4-dichlorophenyl)butan-2-ylamino]-2,2-dimethylbutanoic acid |
|---|---|
| PubChem CID | 122127278 |
| Molecular Formula | C16H23Cl2NO2 |
| Molecular Weight | 332.27 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | 4-[1-(2,4-dichlorophenyl)butan-2-ylamino]-2,2-dimethylbutanoic acid |
| SMILES | CCC(Cc1ccc(Cl)cc1Cl)NCCC(C)(C)C(=O)O |
| InChI | InChI=1S/C16H23Cl2NO2/c1-4-13(19-8-7-16(2,3)15(20)21)9-11-5-6-12(17)10-14(11)18/h5-6,10,13,19H,4,7-9H2,1-3H3,(H,20,21) |
| InChIKey | SJOYWQGQRIYOOO-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.27 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |