C22H29NO2 — CID 122127436
4-[(2-benzyl-3-phenylpropyl)amino]-2,2-dimethylbutanoic acid (PubChem CID 122127436) has the molecular formula C22H29NO2 and a molecular weight of 339.48 g/mol. Its IUPAC name is 4-[(2-benzyl-3-phenylpropyl)amino]-2,2-dimethylbutanoic acid.
| Compound Name | 4-[(2-benzyl-3-phenylpropyl)amino]-2,2-dimethylbutanoic acid |
|---|---|
| PubChem CID | 122127436 |
| Molecular Formula | C22H29NO2 |
| Molecular Weight | 339.48 g/mol |
| Exact Mass | 339.22 |
| IUPAC Name | 4-[(2-benzyl-3-phenylpropyl)amino]-2,2-dimethylbutanoic acid |
| SMILES | CC(C)(CCNCC(Cc1ccccc1)Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C22H29NO2/c1-22(2,21(24)25)13-14-23-17-20(15-18-9-5-3-6-10-18)16-19-11-7-4-8-12-19/h3-12,20,23H,13-17H2,1-2H3,(H,24,25) |
| InChIKey | QCEZMNLTJZMBKV-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.48 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|