C18H22ClNO2S — CID 122129148
2-[[[5-(3-chlorophenyl)thiophen-2-yl]methylamino]methyl]-2-ethylbutanoic acid (PubChem CID 122129148) has the molecular formula C18H22ClNO2S and a molecular weight of 351.90 g/mol. Its IUPAC name is 2-[[[5-(3-chlorophenyl)thiophen-2-yl]methylamino]methyl]-2-ethylbutanoic acid.
| Compound Name | 2-[[[5-(3-chlorophenyl)thiophen-2-yl]methylamino]methyl]-2-ethylbutanoic acid |
|---|---|
| PubChem CID | 122129148 |
| Molecular Formula | C18H22ClNO2S |
| Molecular Weight | 351.90 g/mol |
| Exact Mass | 351.11 |
| IUPAC Name | 2-[[[5-(3-chlorophenyl)thiophen-2-yl]methylamino]methyl]-2-ethylbutanoic acid |
| SMILES | CCC(CC)(CNCc1ccc(-c2cccc(Cl)c2)s1)C(=O)O |
| InChI | InChI=1S/C18H22ClNO2S/c1-3-18(4-2,17(21)22)12-20-11-15-8-9-16(23-15)13-6-5-7-14(19)10-13/h5-10,20H,3-4,11-12H2,1-2H3,(H,21,22) |
| InChIKey | WQGUMRBDGXQPIC-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.90 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |