About tert-butyl (2S)-2-[(5-methoxy-1,3,4-thiadiazol-2-yl)carbamoylamino]propanoate
tert-butyl (2S)-2-[(5-methoxy-1,3,4-thiadiazol-2-yl)carbamoylamino]propanoate (PubChem CID 122131613) has the molecular formula C11H18N4O4S
and a molecular weight of 302.36 g/mol. Its IUPAC name is tert-butyl (2S)-2-[(5-methoxy-1,3,4-thiadiazol-2-yl)carbamoylamino]propanoate.
Molecular Properties
| Compound Name | tert-butyl (2S)-2-[(5-methoxy-1,3,4-thiadiazol-2-yl)carbamoylamino]propanoate |
| PubChem CID | 122131613 |
| Molecular Formula | C11H18N4O4S |
| Molecular Weight | 302.36 g/mol |
| Exact Mass | 302.10 |
| IUPAC Name | tert-butyl (2S)-2-[(5-methoxy-1,3,4-thiadiazol-2-yl)carbamoylamino]propanoate |
| SMILES | COc1nnc(NC(=O)N[C@@H](C)C(=O)OC(C)(C)C)s1 |
| InChI | InChI=1S/C11H18N4O4S/c1-6(7(16)19-11(2,3)4)12-8(17)13-9-14-15-10(18-5)20-9/h6H,1-5H3,(H2,12,13,14,17)/t6-/m0/s1 |
| InChIKey | ACRXNXBBFBFXCO-LURJTMIESA-N |
| XLogP | 1.40 |
| TPSA | 102.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.36 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze tert-butyl (2S)-2-[(5-methoxy-1,3,4-thiadiazol-2-yl)carbamoylamino]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl (2S)-2-[(5-methoxy-1,3,4-thiadiazol-2-yl)carbamoylamino]propanoate?
The IUPAC name of tert-butyl (2S)-2-[(5-methoxy-1,3,4-thiadiazol-2-yl)carbamoylamino]propanoate (CID 122131613) is tert-butyl (2S)-2-[(5-methoxy-1,3,4-thiadiazol-2-yl)carbamoylamino]propanoate.
What is the SMILES notation for tert-butyl (2S)-2-[(5-methoxy-1,3,4-thiadiazol-2-yl)carbamoylamino]propanoate?
The canonical SMILES for tert-butyl (2S)-2-[(5-methoxy-1,3,4-thiadiazol-2-yl)carbamoylamino]propanoate is COc1nnc(NC(=O)N[C@@H](C)C(=O)OC(C)(C)C)s1.
What is the InChIKey of tert-butyl (2S)-2-[(5-methoxy-1,3,4-thiadiazol-2-yl)carbamoylamino]propanoate?
The InChIKey is ACRXNXBBFBFXCO-LURJTMIESA-N. The full InChI is InChI=1S/C11H18N4O4S/c1-6(7(16)19-11(2,3)4)12-8(17)13-9-14-15-10(18-5)20-9/h6H,1-5H3,(H2,12,13,14,17)/t6-/m0/s1.
What are the key properties of tert-butyl (2S)-2-[(5-methoxy-1,3,4-thiadiazol-2-yl)carbamoylamino]propanoate?
tert-butyl (2S)-2-[(5-methoxy-1,3,4-thiadiazol-2-yl)carbamoylamino]propanoate has a molecular weight of 302.36 g/mol, XLogP of 1.40, 4 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl (2S)-2-[(5-methoxy-1,3,4-thiadiazol-2-yl)carbamoylamino]propanoate is sourced from PubChem (CID 122131613), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).