C15H18N4OS2 — CID 122132070
1-(3-pyridin-2-ylpropanoylamino)-3-(2-thiophen-2-ylethyl)thiourea (PubChem CID 122132070) has the molecular formula C15H18N4OS2 and a molecular weight of 334.47 g/mol. Its IUPAC name is 1-(3-pyridin-2-ylpropanoylamino)-3-(2-thiophen-2-ylethyl)thiourea.
| Compound Name | 1-(3-pyridin-2-ylpropanoylamino)-3-(2-thiophen-2-ylethyl)thiourea |
|---|---|
| PubChem CID | 122132070 |
| Molecular Formula | C15H18N4OS2 |
| Molecular Weight | 334.47 g/mol |
| Exact Mass | 334.09 |
| IUPAC Name | 1-(3-pyridin-2-ylpropanoylamino)-3-(2-thiophen-2-ylethyl)thiourea |
| SMILES | O=C(CCc1ccccn1)NNC(=S)NCCc1cccs1 |
| InChI | InChI=1S/C15H18N4OS2/c20-14(7-6-12-4-1-2-9-16-12)18-19-15(21)17-10-8-13-5-3-11-22-13/h1-5,9,11H,6-8,10H2,(H,18,20)(H2,17,19,21) |
| InChIKey | ZPDMDFDNQKESOQ-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 66.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.47 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|