C16H17F2N3OS2 — CID 86979977
1-[3-(3,4-difluorophenyl)propanoylamino]-3-(2-thiophen-2-ylethyl)thiourea (PubChem CID 86979977) has the molecular formula C16H17F2N3OS2 and a molecular weight of 369.46 g/mol. Its IUPAC name is 1-[3-(3,4-difluorophenyl)propanoylamino]-3-(2-thiophen-2-ylethyl)thiourea.
| Compound Name | 1-[3-(3,4-difluorophenyl)propanoylamino]-3-(2-thiophen-2-ylethyl)thiourea |
|---|---|
| PubChem CID | 86979977 |
| Molecular Formula | C16H17F2N3OS2 |
| Molecular Weight | 369.46 g/mol |
| Exact Mass | 369.08 |
| IUPAC Name | 1-[3-(3,4-difluorophenyl)propanoylamino]-3-(2-thiophen-2-ylethyl)thiourea |
| SMILES | O=C(CCc1ccc(F)c(F)c1)NNC(=S)NCCc1cccs1 |
| InChI | InChI=1S/C16H17F2N3OS2/c17-13-5-3-11(10-14(13)18)4-6-15(22)20-21-16(23)19-8-7-12-2-1-9-24-12/h1-3,5,9-10H,4,6-8H2,(H,20,22)(H2,19,21,23) |
| InChIKey | PFBGKGQQFCZUEA-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.46 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|