C18H30N2O4 — CID 122138899
1-[2-(cyclohepten-1-yl)ethyl]-3-(1,4,8-trioxaspiro[4.5]decan-3-ylmethyl)urea (PubChem CID 122138899) has the molecular formula C18H30N2O4 and a molecular weight of 338.45 g/mol. Its IUPAC name is 1-[2-(cyclohepten-1-yl)ethyl]-3-(1,4,8-trioxaspiro[4.5]decan-3-ylmethyl)urea.
| Compound Name | 1-[2-(cyclohepten-1-yl)ethyl]-3-(1,4,8-trioxaspiro[4.5]decan-3-ylmethyl)urea |
|---|---|
| PubChem CID | 122138899 |
| Molecular Formula | C18H30N2O4 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.22 |
| IUPAC Name | 1-[2-(cyclohepten-1-yl)ethyl]-3-(1,4,8-trioxaspiro[4.5]decan-3-ylmethyl)urea |
| SMILES | O=C(NCCC1=CCCCCC1)NCC1COC2(CCOCC2)O1 |
| InChI | InChI=1S/C18H30N2O4/c21-17(19-10-7-15-5-3-1-2-4-6-15)20-13-16-14-23-18(24-16)8-11-22-12-9-18/h5,16H,1-4,6-14H2,(H2,19,20,21) |
| InChIKey | AUXIWCVXUGVLKP-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|