C14H30N2O4 — CID 122141631
tert-butyl N-[3-[2-ethoxyethyl(methyl)amino]-2-hydroxy-2-methylpropyl]carbamate (PubChem CID 122141631) has the molecular formula C14H30N2O4 and a molecular weight of 290.40 g/mol. Its IUPAC name is tert-butyl N-[3-[2-ethoxyethyl(methyl)amino]-2-hydroxy-2-methylpropyl]carbamate.
| Compound Name | tert-butyl N-[3-[2-ethoxyethyl(methyl)amino]-2-hydroxy-2-methylpropyl]carbamate |
|---|---|
| PubChem CID | 122141631 |
| Molecular Formula | C14H30N2O4 |
| Molecular Weight | 290.40 g/mol |
| Exact Mass | 290.22 |
| IUPAC Name | tert-butyl N-[3-[2-ethoxyethyl(methyl)amino]-2-hydroxy-2-methylpropyl]carbamate |
| SMILES | CCOCCN(C)CC(C)(O)CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H30N2O4/c1-7-19-9-8-16(6)11-14(5,18)10-15-12(17)20-13(2,3)4/h18H,7-11H2,1-6H3,(H,15,17) |
| InChIKey | QSKCXJDJGCNHAC-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.40 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|