C20H18FN3O4S — CID 1221428
[2-[[2-[(5R)-2-(4-fluorophenyl)imino-3-methyl-4-oxo-1,3-thiazolidin-5-yl]acetyl]amino]phenyl] acetate (PubChem CID 1221428) has the molecular formula C20H18FN3O4S and a molecular weight of 415.45 g/mol. Its IUPAC name is [2-[[2-[(5R)-2-(4-fluorophenyl)imino-3-methyl-4-oxo-1,3-thiazolidin-5-yl]acetyl]amino]phenyl] acetate.
| Compound Name | [2-[[2-[(5R)-2-(4-fluorophenyl)imino-3-methyl-4-oxo-1,3-thiazolidin-5-yl]acetyl]amino]phenyl] acetate |
|---|---|
| PubChem CID | 1221428 |
| Molecular Formula | C20H18FN3O4S |
| Molecular Weight | 415.45 g/mol |
| Exact Mass | 415.10 |
| IUPAC Name | [2-[[2-[(5R)-2-(4-fluorophenyl)imino-3-methyl-4-oxo-1,3-thiazolidin-5-yl]acetyl]amino]phenyl] acetate |
| SMILES | CC(=O)Oc1ccccc1NC(=O)C[C@H]1S/C(=N/c2ccc(F)cc2)N(C)C1=O |
| InChI | InChI=1S/C20H18FN3O4S/c1-12(25)28-16-6-4-3-5-15(16)23-18(26)11-17-19(27)24(2)20(29-17)22-14-9-7-13(21)8-10-14/h3-10,17H,11H2,1-2H3,(H,23,26)/b22-20+/t17-/m1/s1 |
| InChIKey | BZMUNIQZABYXLJ-MBOBHEEDSA-N |
| XLogP | 3.34 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.45 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|