C23H25N3O4S — CID 21368695
[2-[[2-[3-ethyl-2-(2-ethylphenyl)imino-4-oxo-1,3-thiazolidin-5-yl]acetyl]amino]phenyl] acetate (PubChem CID 21368695) has the molecular formula C23H25N3O4S and a molecular weight of 439.54 g/mol. Its IUPAC name is [2-[[2-[3-ethyl-2-(2-ethylphenyl)imino-4-oxo-1,3-thiazolidin-5-yl]acetyl]amino]phenyl] acetate.
| Compound Name | [2-[[2-[3-ethyl-2-(2-ethylphenyl)imino-4-oxo-1,3-thiazolidin-5-yl]acetyl]amino]phenyl] acetate |
|---|---|
| PubChem CID | 21368695 |
| Molecular Formula | C23H25N3O4S |
| Molecular Weight | 439.54 g/mol |
| Exact Mass | 439.16 |
| IUPAC Name | [2-[[2-[3-ethyl-2-(2-ethylphenyl)imino-4-oxo-1,3-thiazolidin-5-yl]acetyl]amino]phenyl] acetate |
| SMILES | CCc1ccccc1/N=C1\SC(CC(=O)Nc2ccccc2OC(C)=O)C(=O)N1CC |
| InChI | InChI=1S/C23H25N3O4S/c1-4-16-10-6-7-11-17(16)25-23-26(5-2)22(29)20(31-23)14-21(28)24-18-12-8-9-13-19(18)30-15(3)27/h6-13,20H,4-5,14H2,1-3H3,(H,24,28)/b25-23- |
| InChIKey | WKUNBOKSPBLBAP-BZZOAKBMSA-N |
| XLogP | 4.15 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.54 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|