C20H29N5O3 — CID 122147772
[2-(aminomethyl)-3-methylpiperidin-1-yl]-[2-[4-(2-methoxyethoxy)phenyl]-5-methyltriazol-4-yl]methanone (PubChem CID 122147772) has the molecular formula C20H29N5O3 and a molecular weight of 387.48 g/mol. Its IUPAC name is [2-(aminomethyl)-3-methylpiperidin-1-yl]-[2-[4-(2-methoxyethoxy)phenyl]-5-methyltriazol-4-yl]methanone.
| Compound Name | [2-(aminomethyl)-3-methylpiperidin-1-yl]-[2-[4-(2-methoxyethoxy)phenyl]-5-methyltriazol-4-yl]methanone |
|---|---|
| PubChem CID | 122147772 |
| Molecular Formula | C20H29N5O3 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.23 |
| IUPAC Name | [2-(aminomethyl)-3-methylpiperidin-1-yl]-[2-[4-(2-methoxyethoxy)phenyl]-5-methyltriazol-4-yl]methanone |
| SMILES | COCCOc1ccc(-n2nc(C)c(C(=O)N3CCCC(C)C3CN)n2)cc1 |
| InChI | InChI=1S/C20H29N5O3/c1-14-5-4-10-24(18(14)13-21)20(26)19-15(2)22-25(23-19)16-6-8-17(9-7-16)28-12-11-27-3/h6-9,14,18H,4-5,10-13,21H2,1-3H3 |
| InChIKey | SBRXDXBLPDQZFT-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|