C10H12F4N4O2 — CID 122148107
N-[4-(dimethylamino)-6-methoxypyrimidin-5-yl]-2,2,3,3-tetrafluoropropanamide (PubChem CID 122148107) has the molecular formula C10H12F4N4O2 and a molecular weight of 296.22 g/mol. Its IUPAC name is N-[4-(dimethylamino)-6-methoxypyrimidin-5-yl]-2,2,3,3-tetrafluoropropanamide.
| Compound Name | N-[4-(dimethylamino)-6-methoxypyrimidin-5-yl]-2,2,3,3-tetrafluoropropanamide |
|---|---|
| PubChem CID | 122148107 |
| Molecular Formula | C10H12F4N4O2 |
| Molecular Weight | 296.22 g/mol |
| Exact Mass | 296.09 |
| IUPAC Name | N-[4-(dimethylamino)-6-methoxypyrimidin-5-yl]-2,2,3,3-tetrafluoropropanamide |
| SMILES | COc1ncnc(N(C)C)c1NC(=O)C(F)(F)C(F)F |
| InChI | InChI=1S/C10H12F4N4O2/c1-18(2)6-5(7(20-3)16-4-15-6)17-9(19)10(13,14)8(11)12/h4,8H,1-3H3,(H,17,19) |
| InChIKey | MQKYKDPKCREVOQ-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.22 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|