C17H15N3O5 — CID 122148357
N-[2-(methoxymethyl)-1,3-benzoxazol-5-yl]-2-(3-nitrophenyl)acetamide (PubChem CID 122148357) has the molecular formula C17H15N3O5 and a molecular weight of 341.32 g/mol. Its IUPAC name is N-[2-(methoxymethyl)-1,3-benzoxazol-5-yl]-2-(3-nitrophenyl)acetamide.
| Compound Name | N-[2-(methoxymethyl)-1,3-benzoxazol-5-yl]-2-(3-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 122148357 |
| Molecular Formula | C17H15N3O5 |
| Molecular Weight | 341.32 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | N-[2-(methoxymethyl)-1,3-benzoxazol-5-yl]-2-(3-nitrophenyl)acetamide |
| SMILES | COCc1nc2cc(NC(=O)Cc3cccc([N+](=O)[O-])c3)ccc2o1 |
| InChI | InChI=1S/C17H15N3O5/c1-24-10-17-19-14-9-12(5-6-15(14)25-17)18-16(21)8-11-3-2-4-13(7-11)20(22)23/h2-7,9H,8,10H2,1H3,(H,18,21) |
| InChIKey | CURDFNLMCDOCMA-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 107.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.32 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|