C15H22N4O3S — CID 122150241
(3aR,7aR)-N-[5-(methylsulfamoyl)-2-pyridinyl]-2,3,3a,4,5,6,7,7a-octahydroindole-1-carboxamide (PubChem CID 122150241) has the molecular formula C15H22N4O3S and a molecular weight of 338.43 g/mol. Its IUPAC name is (3aR,7aR)-N-[5-(methylsulfamoyl)-2-pyridinyl]-2,3,3a,4,5,6,7,7a-octahydroindole-1-carboxamide.
| Compound Name | (3aR,7aR)-N-[5-(methylsulfamoyl)-2-pyridinyl]-2,3,3a,4,5,6,7,7a-octahydroindole-1-carboxamide |
|---|---|
| PubChem CID | 122150241 |
| Molecular Formula | C15H22N4O3S |
| Molecular Weight | 338.43 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | (3aR,7aR)-N-[5-(methylsulfamoyl)-2-pyridinyl]-2,3,3a,4,5,6,7,7a-octahydroindole-1-carboxamide |
| SMILES | CNS(=O)(=O)c1ccc(NC(=O)N2CC[C@H]3CCCC[C@H]32)nc1 |
| InChI | InChI=1S/C15H22N4O3S/c1-16-23(21,22)12-6-7-14(17-10-12)18-15(20)19-9-8-11-4-2-3-5-13(11)19/h6-7,10-11,13,16H,2-5,8-9H2,1H3,(H,17,18,20)/t11-,13-/m1/s1 |
| InChIKey | FUTANJKGHVPVEX-DGCLKSJQSA-N |
| XLogP | 1.79 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.43 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |