C11H16N4OS — CID 86807487
N-(thiadiazol-5-yl)-2,3,3a,4,5,6,7,7a-octahydroindole-1-carboxamide (PubChem CID 86807487) has the molecular formula C11H16N4OS and a molecular weight of 252.34 g/mol. Its IUPAC name is N-(thiadiazol-5-yl)-2,3,3a,4,5,6,7,7a-octahydroindole-1-carboxamide.
| Compound Name | N-(thiadiazol-5-yl)-2,3,3a,4,5,6,7,7a-octahydroindole-1-carboxamide |
|---|---|
| PubChem CID | 86807487 |
| Molecular Formula | C11H16N4OS |
| Molecular Weight | 252.34 g/mol |
| Exact Mass | 252.10 |
| IUPAC Name | N-(thiadiazol-5-yl)-2,3,3a,4,5,6,7,7a-octahydroindole-1-carboxamide |
| SMILES | O=C(Nc1cnns1)N1CCC2CCCCC21 |
| InChI | InChI=1S/C11H16N4OS/c16-11(13-10-7-12-14-17-10)15-6-5-8-3-1-2-4-9(8)15/h7-9H,1-6H2,(H,13,16) |
| InChIKey | OWRXMSYJDUQFPC-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.34 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |