C19H20N6 — CID 122153997
2-[(2-amino-3-pyridinyl)methylamino]-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine-3,4-dicarbonitrile (PubChem CID 122153997) has the molecular formula C19H20N6 and a molecular weight of 332.41 g/mol. Its IUPAC name is 2-[(2-amino-3-pyridinyl)methylamino]-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine-3,4-dicarbonitrile.
| Compound Name | 2-[(2-amino-3-pyridinyl)methylamino]-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine-3,4-dicarbonitrile |
|---|---|
| PubChem CID | 122153997 |
| Molecular Formula | C19H20N6 |
| Molecular Weight | 332.41 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | 2-[(2-amino-3-pyridinyl)methylamino]-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine-3,4-dicarbonitrile |
| SMILES | N#Cc1c(NCc2cccnc2N)nc2c(c1C#N)CCCCCC2 |
| InChI | InChI=1S/C19H20N6/c20-10-15-14-7-3-1-2-4-8-17(14)25-19(16(15)11-21)24-12-13-6-5-9-23-18(13)22/h5-6,9H,1-4,7-8,12H2,(H2,22,23)(H,24,25) |
| InChIKey | YPPYOYZMURPYHC-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 111.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.41 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |