C20H27N5 — CID 100639693
2-[[(2R)-2-cyclopropyl-2-(dimethylamino)ethyl]amino]-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine-3,4-dicarbonitrile (PubChem CID 100639693) has the molecular formula C20H27N5 and a molecular weight of 337.47 g/mol. Its IUPAC name is 2-[[(2R)-2-cyclopropyl-2-(dimethylamino)ethyl]amino]-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine-3,4-dicarbonitrile.
| Compound Name | 2-[[(2R)-2-cyclopropyl-2-(dimethylamino)ethyl]amino]-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine-3,4-dicarbonitrile |
|---|---|
| PubChem CID | 100639693 |
| Molecular Formula | C20H27N5 |
| Molecular Weight | 337.47 g/mol |
| Exact Mass | 337.23 |
| IUPAC Name | 2-[[(2R)-2-cyclopropyl-2-(dimethylamino)ethyl]amino]-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine-3,4-dicarbonitrile |
| SMILES | CN(C)[C@@H](CNc1nc2c(c(C#N)c1C#N)CCCCCC2)C1CC1 |
| InChI | InChI=1S/C20H27N5/c1-25(2)19(14-9-10-14)13-23-20-17(12-22)16(11-21)15-7-5-3-4-6-8-18(15)24-20/h14,19H,3-10,13H2,1-2H3,(H,23,24)/t19-/m0/s1 |
| InChIKey | AOXYWWMBJMHAQH-IBGZPJMESA-N |
| XLogP | 3.24 |
| TPSA | 75.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.47 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |