C18H20F2N4 — CID 128902050
2-[3-(2,2-difluoroethyl)azetidin-1-yl]-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine-3,4-dicarbonitrile (PubChem CID 128902050) has the molecular formula C18H20F2N4 and a molecular weight of 330.38 g/mol. Its IUPAC name is 2-[3-(2,2-difluoroethyl)azetidin-1-yl]-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine-3,4-dicarbonitrile.
| Compound Name | 2-[3-(2,2-difluoroethyl)azetidin-1-yl]-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine-3,4-dicarbonitrile |
|---|---|
| PubChem CID | 128902050 |
| Molecular Formula | C18H20F2N4 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | 2-[3-(2,2-difluoroethyl)azetidin-1-yl]-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine-3,4-dicarbonitrile |
| SMILES | N#Cc1c(N2CC(CC(F)F)C2)nc2c(c1C#N)CCCCCC2 |
| InChI | InChI=1S/C18H20F2N4/c19-17(20)7-12-10-24(11-12)18-15(9-22)14(8-21)13-5-3-1-2-4-6-16(13)23-18/h12,17H,1-7,10-11H2 |
| InChIKey | SYBVWKRPNCXBLQ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 63.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |