C10H10ClN3 — CID 82611386
3-amino-2-chloro-5,6,7,8-tetrahydroquinoline-4-carbonitrile (PubChem CID 82611386) has the molecular formula C10H10ClN3 and a molecular weight of 207.66 g/mol. Its IUPAC name is 3-amino-2-chloro-5,6,7,8-tetrahydroquinoline-4-carbonitrile.
| Compound Name | 3-amino-2-chloro-5,6,7,8-tetrahydroquinoline-4-carbonitrile |
|---|---|
| PubChem CID | 82611386 |
| Molecular Formula | C10H10ClN3 |
| Molecular Weight | 207.66 g/mol |
| Exact Mass | 207.06 |
| IUPAC Name | 3-amino-2-chloro-5,6,7,8-tetrahydroquinoline-4-carbonitrile |
| SMILES | N#Cc1c(N)c(Cl)nc2c1CCCC2 |
| InChI | InChI=1S/C10H10ClN3/c11-10-9(13)7(5-12)6-3-1-2-4-8(6)14-10/h1-4,13H2 |
| InChIKey | CECRXGMYXDQPON-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 62.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.66 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|