C19H25N5O — CID 167761000
2-[(3-hydroxy-1-methylpyrrolidin-3-yl)methylamino]-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine-3,4-dicarbonitrile (PubChem CID 167761000) has the molecular formula C19H25N5O and a molecular weight of 339.44 g/mol. Its IUPAC name is 2-[(3-hydroxy-1-methylpyrrolidin-3-yl)methylamino]-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine-3,4-dicarbonitrile.
| Compound Name | 2-[(3-hydroxy-1-methylpyrrolidin-3-yl)methylamino]-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine-3,4-dicarbonitrile |
|---|---|
| PubChem CID | 167761000 |
| Molecular Formula | C19H25N5O |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.21 |
| IUPAC Name | 2-[(3-hydroxy-1-methylpyrrolidin-3-yl)methylamino]-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine-3,4-dicarbonitrile |
| SMILES | CN1CCC(O)(CNc2nc3c(c(C#N)c2C#N)CCCCCC3)C1 |
| InChI | InChI=1S/C19H25N5O/c1-24-9-8-19(25,13-24)12-22-18-16(11-21)15(10-20)14-6-4-2-3-5-7-17(14)23-18/h25H,2-9,12-13H2,1H3,(H,22,23) |
| InChIKey | LPYZDHWDMZAGOH-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 95.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |