C12H19N5O6 — CID 122154365
methyl 2,6-bis(2-methoxyethylamino)-5-nitropyrimidine-4-carboxylate (PubChem CID 122154365) has the molecular formula C12H19N5O6 and a molecular weight of 329.31 g/mol. Its IUPAC name is methyl 2,6-bis(2-methoxyethylamino)-5-nitropyrimidine-4-carboxylate.
| Compound Name | methyl 2,6-bis(2-methoxyethylamino)-5-nitropyrimidine-4-carboxylate |
|---|---|
| PubChem CID | 122154365 |
| Molecular Formula | C12H19N5O6 |
| Molecular Weight | 329.31 g/mol |
| Exact Mass | 329.13 |
| IUPAC Name | methyl 2,6-bis(2-methoxyethylamino)-5-nitropyrimidine-4-carboxylate |
| SMILES | COCCNc1nc(NCCOC)c([N+](=O)[O-])c(C(=O)OC)n1 |
| InChI | InChI=1S/C12H19N5O6/c1-21-6-4-13-10-9(17(19)20)8(11(18)23-3)15-12(16-10)14-5-7-22-2/h4-7H2,1-3H3,(H2,13,14,15,16) |
| InChIKey | LKVCBAAJHYJOCE-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 137.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.31 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|