C15H22ClN3O3 — CID 122154949
methyl (2S)-2-[3-[(2-chloropyridine-4-carbonyl)amino]propylamino]-3-methylbutanoate (PubChem CID 122154949) has the molecular formula C15H22ClN3O3 and a molecular weight of 327.81 g/mol. Its IUPAC name is methyl (2S)-2-[3-[(2-chloropyridine-4-carbonyl)amino]propylamino]-3-methylbutanoate.
| Compound Name | methyl (2S)-2-[3-[(2-chloropyridine-4-carbonyl)amino]propylamino]-3-methylbutanoate |
|---|---|
| PubChem CID | 122154949 |
| Molecular Formula | C15H22ClN3O3 |
| Molecular Weight | 327.81 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | methyl (2S)-2-[3-[(2-chloropyridine-4-carbonyl)amino]propylamino]-3-methylbutanoate |
| SMILES | COC(=O)[C@@H](NCCCNC(=O)c1ccnc(Cl)c1)C(C)C |
| InChI | InChI=1S/C15H22ClN3O3/c1-10(2)13(15(21)22-3)18-6-4-7-19-14(20)11-5-8-17-12(16)9-11/h5,8-10,13,18H,4,6-7H2,1-3H3,(H,19,20)/t13-/m0/s1 |
| InChIKey | LOXHREMVCVBVJW-ZDUSSCGKSA-N |
| XLogP | 1.64 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.81 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|