C17H22N2OS2 — CID 122157607
2-(1,4-dithian-2-yl)-N-[3-(1H-indol-3-yl)propyl]acetamide (PubChem CID 122157607) has the molecular formula C17H22N2OS2 and a molecular weight of 334.51 g/mol. Its IUPAC name is 2-(1,4-dithian-2-yl)-N-[3-(1H-indol-3-yl)propyl]acetamide.
| Compound Name | 2-(1,4-dithian-2-yl)-N-[3-(1H-indol-3-yl)propyl]acetamide |
|---|---|
| PubChem CID | 122157607 |
| Molecular Formula | C17H22N2OS2 |
| Molecular Weight | 334.51 g/mol |
| Exact Mass | 334.12 |
| IUPAC Name | 2-(1,4-dithian-2-yl)-N-[3-(1H-indol-3-yl)propyl]acetamide |
| SMILES | O=C(CC1CSCCS1)NCCCc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C17H22N2OS2/c20-17(10-14-12-21-8-9-22-14)18-7-3-4-13-11-19-16-6-2-1-5-15(13)16/h1-2,5-6,11,14,19H,3-4,7-10,12H2,(H,18,20) |
| InChIKey | OPRNZNUGXXYGJQ-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.51 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|